PRODUCTS
PRODUCTS
Acetamiprid |
| Product name: | Acetamiprid |
| CAS No.: | 135410-20-7;160430-64-8 |
| Molecular weight: | 222.6741 |
| Molecular formula: | C10H11ClN4 |
| InChI: | InChI=1/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3 |
| Structural formula: |  |
| Density: | 1.17g/cm3 |
| Melting point: | 101-103℃ |
| Water solubility: | 4200ml/L |
| Boiling point: | 352.4°C at 760 mmHg |
| Flash point: | 166.9°C |
| Vapor pressure: | 3.85E-05mmHg at 25°C |
| Uses: | It is the same series with imidacloprid, but its insecticidal spectrum is more extensive than imidacloprid, which has better control effect on cucumbers, apples, oranges and tobacco aphids.Because of the unique mechanism of Acetamiprid, it has good effect on pesticides of organophosphorus, carbamate, and pyrethroids. |
